EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5N3O2 |
| Net Charge | 0 |
| Average Mass | 187.158 |
| Monoisotopic Mass | 187.03818 |
| SMILES | N#Cc1c(-c2ccccc2)no[n+]1[O-] |
| InChI | InChI=1S/C9H5N3O2/c10-6-8-9(11-14-12(8)13)7-4-2-1-3-5-7/h1-5H |
| InChIKey | PMYJGTWUVVVOFO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| Biological Role: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-phenyl-3-furoxancarbonitrile (CHEBI:180495) has role geroprotector (CHEBI:176497) |
| 4-phenyl-3-furoxancarbonitrile (CHEBI:180495) has role nitric oxide donor (CHEBI:50566) |
| 4-phenyl-3-furoxancarbonitrile (CHEBI:180495) has role platelet aggregation inhibitor (CHEBI:50427) |
| 4-phenyl-3-furoxancarbonitrile (CHEBI:180495) has role soluble guanylate cyclase activator (CHEBI:76022) |
| 4-phenyl-3-furoxancarbonitrile (CHEBI:180495) has role vasodilator agent (CHEBI:35620) |
| 4-phenyl-3-furoxancarbonitrile (CHEBI:180495) is a N-oxide (CHEBI:35580) |
| 4-phenyl-3-furoxancarbonitrile (CHEBI:180495) is a 1,2,5-oxadiazole (CHEBI:46815) |
| 4-phenyl-3-furoxancarbonitrile (CHEBI:180495) is a benzenes (CHEBI:22712) |
| 4-phenyl-3-furoxancarbonitrile (CHEBI:180495) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 4-phenyl-1,2,5-oxadiazole-3-carbonitrile 2-oxide |
| Synonyms | Source |
|---|---|
| RVC-589 | ChEBI |
| 2-oxo-4-phenyl-1,2,5λ5-oxadiazole-3-carbonitrile | IUPAC |
| 3-cyano-4-phenylfurazan 2-oxide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1692 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:125520-62-9 | ChEBI |
| Citations |
|---|