EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:180485 - amperozide hydrochloride
| Formula | C23H29F2N3O.HCl |
| Net Charge | 0 |
| Average Mass | 437.962 |
| Monoisotopic Mass | 437.20455 |
| SMILES | CCNC(=O)N1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C23H29F2N3O.ClH/c1-2-26-23(29)28-16-14-27(15-17-28)13-3-4-22(18-5-9-20(24)10-6-18)19-7-11-21(25)12-8-19;/h5-12,22H,2-4,13-17H2,1H3,(H,26,29);1H |
| InChIKey | OEQHKNWFXHBJIT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amperozide hydrochloride (CHEBI:180485) has part amperozide(1+) (CHEBI:180484) |
| amperozide hydrochloride (CHEBI:180485) has role anxiolytic drug (CHEBI:35474) |
| amperozide hydrochloride (CHEBI:180485) has role dopamine uptake inhibitor (CHEBI:51039) |
| amperozide hydrochloride (CHEBI:180485) has role geroprotector (CHEBI:176497) |
| amperozide hydrochloride (CHEBI:180485) has role second generation antipsychotic (CHEBI:65191) |
| amperozide hydrochloride (CHEBI:180485) has role serotonergic antagonist (CHEBI:48279) |
| amperozide hydrochloride (CHEBI:180485) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-[4,4-bis(4-fluorophenyl)butyl]-N-ethylpiperazine-1-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| 1-[4,4-bis(4-fluorophenyl)butyl]-4-(ethylcarbamoyl)piperazin-1-ium chloride | IUPAC |
| 4-(4,4-bis(p-fluorophenyl)butyl)-N-ethyl-1-piperazinecarboxamide hydrochloride | ChemIDplus |
| amperozide HCl | ChemIDplus |
| amperozide monohydrochloride | ChEBI |
| FG 5606 | ChEBI |
| FG-5606 | ChEBI |
| Brand Name | Source |
|---|---|
| Hogpax | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 66063 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:75529-73-6 | ChemIDplus |
| CAS:86725-37-3 | ChemIDplus |
| Citations |
|---|