EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O |
| Net Charge | 0 |
| Average Mass | 140.226 |
| Monoisotopic Mass | 140.12012 |
| SMILES | CCC/C=C/CCC(C)=O |
| InChI | InChI=1S/C9H16O/c1-3-4-5-6-7-8-9(2)10/h5-6H,3-4,7-8H2,1-2H3/b6-5+ |
| InChIKey | RXFZCBZCGBDPDT-AATRIKPKSA-N |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5E)-5-nonen-2-one (CHEBI:180466) has role flavouring agent (CHEBI:35617) |
| (5E)-5-nonen-2-one (CHEBI:180466) is a 5-nonen-2-one (CHEBI:167144) |
| IUPAC Name |
|---|
| (5E)-non-5-en-2-one |
| Synonyms | Source |
|---|---|
| trans-non-5-en-2-one | ChEBI |
| FEMA 4326 | ChEBI |
| (E)-non-5-en-2-one | ChEBI |
| (E)-5-nonen-2-one | ChEBI |
| trans-5-nonen-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5492098 | Reaxys |
| CAS:75606-70-1 | ChemIDplus |
| Citations |
|---|