EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H68N4O12 |
| Net Charge | 0 |
| Average Mass | 797.000 |
| Monoisotopic Mass | 796.48337 |
| SMILES | CC(C)C[C@H]1C(=O)O[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C)C(=O)N1C |
| InChI | InChI=1S/C40H68N4O12/c1-21(2)17-29-37(49)53-26(10)34(46)42(14)31(19-23(5)6)39(51)55-28(12)36(48)44(16)32(20-24(7)8)40(52)56-27(11)35(47)43(15)30(18-22(3)4)38(50)54-25(9)33(45)41(29)13/h21-32H,17-20H2,1-16H3/t25-,26-,27-,28-,29+,30+,31+,32+/m1/s1 |
| InChIKey | YTZVBUCDOMTKGC-AUQHPUDISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF1022F (CHEBI:180465) is a cyclooctadepsipeptide (CHEBI:78740) |
| UniProt Name | Source |
|---|---|
| PF1022F | UniProt |
| Citations |
|---|