EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H72N4O12 |
| Net Charge | 0 |
| Average Mass | 873.098 |
| Monoisotopic Mass | 872.51467 |
| SMILES | CC(C)C[C@H]1C(=O)O[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](Cc2ccccc2)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C)C(=O)N1C |
| InChI | InChI=1S/C46H72N4O12/c1-26(2)21-34-43(55)59-30(9)39(51)47(12)35(22-27(3)4)44(56)60-32(11)41(53)49(14)37(24-29(7)8)46(58)62-38(25-33-19-17-16-18-20-33)42(54)50(15)36(23-28(5)6)45(57)61-31(10)40(52)48(34)13/h16-20,26-32,34-38H,21-25H2,1-15H3/t30-,31-,32-,34+,35+,36+,37+,38-/m1/s1 |
| InChIKey | MKIYOQCNSJBUEG-CRZGXZBZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF1022D (CHEBI:180464) is a cyclooctadepsipeptide (CHEBI:78740) |
| Synonym | Source |
|---|---|
| PF-1022D | ChEBI |
| UniProt Name | Source |
|---|---|
| PF1022D | UniProt |
| Citations |
|---|