EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H76N4O12 |
| Net Charge | 0 |
| Average Mass | 949.196 |
| Monoisotopic Mass | 948.54597 |
| SMILES | CC(C)C[C@H]1C(=O)O[C@H](Cc2ccccc2)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](Cc2ccccc2)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C)C(=O)N1C |
| InChI | InChI=1S/C52H76N4O12/c1-31(2)25-39-49(61)65-35(9)45(57)53(11)42(28-34(7)8)52(64)68-44(30-38-23-19-16-20-24-38)48(60)56(14)40(26-32(3)4)50(62)66-36(10)46(58)54(12)41(27-33(5)6)51(63)67-43(47(59)55(39)13)29-37-21-17-15-18-22-37/h15-24,31-36,39-44H,25-30H2,1-14H3/t35-,36-,39+,40+,41+,42+,43-,44-/m1/s1 |
| InChIKey | YJNUXGPXJFAUQJ-LYWANRAQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF1022A (CHEBI:180461) is a cyclooctadepsipeptide (CHEBI:78740) |
| UniProt Name | Source |
|---|---|
| PF1022A | UniProt |
| Citations |
|---|