EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H27ClO3 |
| Net Charge | 0 |
| Average Mass | 326.864 |
| Monoisotopic Mass | 326.16487 |
| SMILES | [H][C@@]1([C@@H](Cl)CC)C[C@@H]2O[C@@H]2[C@H]1/C=C\C/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C18H27ClO3/c1-2-15(19)14-12-16-18(22-16)13(14)10-8-6-4-3-5-7-9-11-17(20)21/h3-4,8,10,13-16,18H,2,5-7,9,11-12H2,1H3,(H,20,21)/b4-3-,10-8-/t13-,14+,15-,16-,18+/m0/s1 |
| InChIKey | BUSAMCWWFKPNGV-SOVGUPCDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Egregiachloride A (CHEBI:180452) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (6Z,9Z)-10-[(1R,2S,3R,5S)-3-[(1S)-1-chloropropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]deca-6,9-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23339750 | ChemSpider |
| LMFA03120052 | LIPID MAPS |