EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O2 |
| Net Charge | 0 |
| Average Mass | 114.144 |
| Monoisotopic Mass | 114.06808 |
| SMILES | CC(C)=C(C)C(=O)O |
| InChI | InChI=1S/C6H10O2/c1-4(2)5(3)6(7)8/h1-3H3,(H,7,8) |
| InChIKey | UAXOELSVPTZZQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethyl acrylic acid (CHEBI:180389) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 2,3-dimethylbut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 466257 | ChemSpider |
| LMFA01020116 | LIPID MAPS |