EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20O10 |
| Net Charge | 0 |
| Average Mass | 456.403 |
| Monoisotopic Mass | 456.10565 |
| SMILES | COc1cc(C(=O)O[C@@H]2Cc3c(O)cc(O)cc3O[C@@H]2c2cc(O)c(O)c(O)c2)ccc1O |
| InChI | InChI=1S/C23H20O10/c1-31-19-6-10(2-3-14(19)25)23(30)33-20-9-13-15(26)7-12(24)8-18(13)32-22(20)11-4-16(27)21(29)17(28)5-11/h2-8,20,22,24-29H,9H2,1H3/t20-,22-/m1/s1 |
| InChIKey | ZQUCIEABYDEGHK-IFMALSPDSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epigallocatechin 3-O-vanillate (CHEBI:180380) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 4-hydroxy-3-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| LMPK12020132 | LIPID MAPS |
| 24842573 | ChemSpider |