EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O3 |
| Net Charge | 0 |
| Average Mass | 214.305 |
| Monoisotopic Mass | 214.15689 |
| SMILES | CCCCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C12H22O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h2-10H2,1H3,(H,14,15) |
| InChIKey | DZHSPYMHDVROSM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxolauric acid (CHEBI:18037) has functional parent dodecanoic acid (CHEBI:30805) |
| 3-oxolauric acid (CHEBI:18037) is a 3-oxo fatty acid (CHEBI:134416) |
| 3-oxolauric acid (CHEBI:18037) is conjugate acid of 3-oxododecanoate (CHEBI:29743) |
| Incoming Relation(s) |
| 3-oxo-N-[(3S)-2-oxopyrrolidin-3-yl]dodecanamide (CHEBI:44612) has functional parent 3-oxolauric acid (CHEBI:18037) |
| 3-oxolauroyl-CoA (CHEBI:27868) has functional parent 3-oxolauric acid (CHEBI:18037) |
| 3-oxododecanoate (CHEBI:29743) is conjugate base of 3-oxolauric acid (CHEBI:18037) |
| IUPAC Name |
|---|
| 3-oxododecanoic acid |
| Synonyms | Source |
|---|---|
| 3-Oxododecanoate | KEGG COMPOUND |
| 3-oxododecanoic acid | ChEBI |
| 3-Oxododecanoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3LA | PDBeChem |
| C02367 | KEGG COMPOUND |
| LMFA01060091 | LIPID MAPS |