EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O6 |
| Net Charge | -2 |
| Average Mass | 198.130 |
| Monoisotopic Mass | 198.01754 |
| SMILES | O=C([O-])/C=C/C(=O)CC(=O)CC(=O)[O-] |
| InChI | InChI=1S/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/p-2/b2-1+ |
| InChIKey | GACSIVHAIFQKTC-OWOJBTEDSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-fumarylacetoacetate(2−) (CHEBI:18034) has functional parent oct-2-enedioate (CHEBI:36280) |
| 4-fumarylacetoacetate(2−) (CHEBI:18034) has role human metabolite (CHEBI:77746) |
| 4-fumarylacetoacetate(2−) (CHEBI:18034) has role metabolite (CHEBI:25212) |
| 4-fumarylacetoacetate(2−) (CHEBI:18034) is a dicarboxylic acid dianion (CHEBI:28965) |
| 4-fumarylacetoacetate(2−) (CHEBI:18034) is conjugate base of 4-fumarylacetoacetic acid (CHEBI:30907) |
| Incoming Relation(s) |
| 4-fumarylacetoacetic acid (CHEBI:30907) is conjugate acid of 4-fumarylacetoacetate(2−) (CHEBI:18034) |
| IUPAC Name |
|---|
| (2E)-4,6-dioxooct-2-enedioate |
| Synonyms | Source |
|---|---|
| 4-fumarylacetoacetate | ChEBI |
| 4-fumarylacetoacetate dianion | ChEBI |
| fumarylacetoacetate | UM-BBD |
| UniProt Name | Source |
|---|---|
| 4-fumarylacetoacetate | UniProt |
| Citations |
|---|