EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O4 |
| Net Charge | 0 |
| Average Mass | 202.250 |
| Monoisotopic Mass | 202.12051 |
| SMILES | CC(CCCC(C)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H18O4/c1-7(6-9(11)12)4-3-5-8(2)10(13)14/h7-8H,3-6H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | YXTSFTNUPXGYDZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-Dimethyl-1,8-octanedioic acid (CHEBI:180323) is a medium-chain fatty acid (CHEBI:59554) |
| Incoming Relation(s) |
| 2,6-dimethyloctanedioic acid coa (CHEBI:233747) has functional parent 2,6-Dimethyl-1,8-octanedioic acid (CHEBI:180323) |
| IUPAC Name |
|---|
| 2,6-dimethyloctanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 167802 | ChemSpider |
| LMFA01170129 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:3269-74-7 | ChemIDplus |