EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)[C@@H]1CC=C2CCC[C@@H](C)[C@]2(C)C1 |
| InChI | InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h9,12-13H,1,5-8,10H2,2-4H3/t12-,13-,15+/m1/s1 |
| InChIKey | YONHOSLUBQJXPR-NFAWXSAZSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-aristolochene (CHEBI:18027) is a aristolochene (CHEBI:36529) |
| (−)-aristolochene (CHEBI:18027) is enantiomer of (+)-aristolochene (CHEBI:43445) |
| Incoming Relation(s) |
| (+)-aristolochene (CHEBI:43445) is enantiomer of (−)-aristolochene (CHEBI:18027) |
| IUPAC Names |
|---|
| (4R,4aS,6R)-4,4a-dimethyl-6-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| 4βH,5α-eremophila-9,11-diene |
| Synonyms | Source |
|---|---|
| (1R,7R,8aS)-aristolochene | ChEBI |
| Aristolochene | KEGG COMPOUND |
| Aristolochene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (-)-aristolochene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02004 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2249047 | Beilstein |
| Beilstein:3588802 | Beilstein |
| CAS:26620-71-3 | ChemIDplus |