EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18OS |
| Net Charge | 0 |
| Average Mass | 174.309 |
| Monoisotopic Mass | 174.10784 |
| SMILES | CCCCCC(=O)SCCC |
| InChI | InChI=1S/C9H18OS/c1-3-5-6-7-9(10)11-8-4-2/h3-8H2,1-2H3 |
| InChIKey | XWEXGRZJPGGXCY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia mangostana (ncbitaxon:58228) | - | PubMed (30034986) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-propyl hexanethioate (CHEBI:180249) has functional parent hexanoic acid (CHEBI:30776) |
| S-propyl hexanethioate (CHEBI:180249) has functional parent propane-1-thiol (CHEBI:8473) |
| S-propyl hexanethioate (CHEBI:180249) has role plant metabolite (CHEBI:76924) |
| S-propyl hexanethioate (CHEBI:180249) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| S-propyl hexanethioate |
| Synonyms | Source |
|---|---|
| hexanethioic acid S-propyl ester | ChEBI |
| 1-(propylsulfanyl)hexan-1-one | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039466 | HMDB |
| 469089 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:2432-78-2 | PubChem Compound |
| Citations |
|---|