EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O2 |
| Net Charge | 0 |
| Average Mass | 170.252 |
| Monoisotopic Mass | 170.13068 |
| SMILES | C=C[C@]1(C)CC[C@@H](O)C(C)(C)O1 |
| InChI | InChI=1S/C10H18O2/c1-5-10(4)7-6-8(11)9(2,3)12-10/h5,8,11H,1,6-7H2,2-4H3/t8-,10-/m1/s1 |
| InChIKey | BCTBAGTXFYWYMW-PSASIEDQSA-N |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Linalool oxide (trans-pyranoid) (CHEBI:180233) is a linalool oxide pyranoside (CHEBI:144708) |
| IUPAC Name |
|---|
| (3R,6S)-6-ethenyl-2,2,6-trimethyloxan-3-ol |
| Manual Xrefs | Databases |
|---|---|
| 4933201 | ChemSpider |
| HMDB0031440 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:39028-58-5 | ChemIDplus |