EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O4 |
| Net Charge | 0 |
| Average Mass | 172.140 |
| Monoisotopic Mass | 172.04841 |
| SMILES | NC(Cn1ccc(=O)o1)C(=O)O |
| InChI | InChI=1S/C6H8N2O4/c7-4(6(10)11)3-8-2-1-5(9)12-8/h1-2,4H,3,7H2,(H,10,11) |
| InChIKey | BDHFFHBFJUZSBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-alpha-Amino-5-oxo-2(5H)-isoxazolepropanoic acid (CHEBI:180201) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-(5-oxo-1,2-oxazol-2-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 156181 | ChemSpider |
| HMDB0034322 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:24676-28-6 | ChemIDplus |