EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:180192 - 4-hydroxy-valeric acid
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | CC(O)CCC(=O)O |
| InChI | InChI=1S/C5H10O3/c1-4(6)2-3-5(7)8/h4,6H,2-3H2,1H3,(H,7,8) |
| InChIKey | FMHKPLXYWVCLME-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-valeric acid (CHEBI:180192) is a hydroxy fatty acid (CHEBI:24654) |
| 4-hydroxy-valeric acid (CHEBI:180192) is conjugate acid of 4-hydroxypentanoate (CHEBI:231928) |
| Incoming Relation(s) |
| 4-hydroxypentanoate (CHEBI:231928) is conjugate base of 4-hydroxy-valeric acid (CHEBI:180192) |
| IUPAC Name |
|---|
| 4-hydroxypentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050009 | LIPID MAPS |
| 102591 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13532-37-1 | ChemIDplus |