EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N2O3 |
| Net Charge | 0 |
| Average Mass | 168.152 |
| Monoisotopic Mass | 168.05349 |
| SMILES | NC(C(=O)O)C(=O)c1cccn1 |
| InChI | InChI=1S/C7H8N2O3/c8-5(7(11)12)6(10)4-2-1-3-9-4/h1-3,5,9H,8H2,(H,11,12) |
| InChIKey | ADLMGGMQERWRHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Pyrroloylglycine (CHEBI:180143) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-oxo-3-(1H-pyrrol-2-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 73703452 | ChemSpider |