EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O10 |
| Net Charge | 0 |
| Average Mass | 388.369 |
| Monoisotopic Mass | 388.13695 |
| SMILES | C=C[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C(C(=O)OC)[C@H]1CC=O |
| InChI | InChI=1S/C17H24O10/c1-3-8-9(4-5-18)10(15(23)24-2)7-25-16(8)27-17-14(22)13(21)12(20)11(6-19)26-17/h3,5,7-9,11-14,16-17,19-22H,1,4,6H2,2H3/t8-,9+,11-,12-,13+,14-,16+,17+/m1/s1 |
| InChIKey | CSKKDSFETGLMSB-NRZPKYKESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-secologanin (CHEBI:18002) has role plant metabolite (CHEBI:76924) |
| (−)-secologanin (CHEBI:18002) is a aldehyde (CHEBI:17478) |
| (−)-secologanin (CHEBI:18002) is a enoate ester (CHEBI:51702) |
| (−)-secologanin (CHEBI:18002) is a methyl ester (CHEBI:25248) |
| (−)-secologanin (CHEBI:18002) is a pyrans (CHEBI:26407) |
| (−)-secologanin (CHEBI:18002) is a secoiridoid glycoside (CHEBI:50274) |
| (−)-secologanin (CHEBI:18002) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| methyl (2S,3R,4S)-3-ethenyl-2-(β-D-glucopyranosyloxy)-4-(2-oxoethyl)-3,4-dihydro-2H-pyran-5-carboxylate |
| Synonyms | Source |
|---|---|
| 3-Ethenyl-2-(beta-D-glucopyranosyloxy)-3,4-dihydro-4-(2-oxoethyl)-2H-pyran-5-carboxylic acid, methyl ester | ChemIDplus |
| methyl (2S,3R,4S)-4-(formylmethyl)-2-(β-D-glucopyranosyloxy)-3,4-dihydro-3-vinyl-2H-pyran-5-carboxylate | IUBMB |
| METHYL (2S,3R,4S)-2-(BETA-D-GLUCOPYRANOSYLOXY)-4-(2-OXOETHYL)-3-VINYL-3,4-DIHYDRO-2H-PYRAN-5-CARBOXYLATE | PDBeChem |
| (-)-Secologanin | KEGG COMPOUND |
| Secologanin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| secologanin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003098 | KNApSAcK |
| C01852 | KEGG COMPOUND |
| LMPR0102070002 | LIPID MAPS |
| SCG | PDBeChem |
| Secologanin | Wikipedia |
| SECOLOGANIN-CPD | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1441446 | Reaxys |
| Beilstein:1441446 | Beilstein |
| CAS:19351-63-4 | ChemIDplus |
| CAS:19351-63-4 | KEGG COMPOUND |
| Citations |
|---|