EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O3 |
| Net Charge | 0 |
| Average Mass | 370.533 |
| Monoisotopic Mass | 370.25079 |
| SMILES | [H][C@]12CCC3=C4CC[C@]([H])([C@H](C)CCC(=O)O)[C@@]4(C)C=C[C@]3([H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C24H34O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h11,13,15-16,19,21H,4-10,12,14H2,1-3H3,(H,26,27)/t15-,16-,19-,21+,23+,24-/m1/s1 |
| InChIKey | ZMSHFWQIVBSXGN-RQEZFVBVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Oxo-5beta-chola-8(14),11-dien-24-oic Acid (CHEBI:179986) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(5R,9R,10S,13R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,9,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMST04010331 | LIPID MAPS |
| 4447166 | ChemSpider |