EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O2 |
| Net Charge | 0 |
| Average Mass | 158.241 |
| Monoisotopic Mass | 158.13068 |
| SMILES | CCCC(=O)CCCCCO |
| InChI | InChI=1S/C9H18O2/c1-2-6-9(11)7-4-3-5-8-10/h10H,2-8H2,1H3 |
| InChIKey | AGSKJBKUKWUEEU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dacus halfordiae (ncbitaxon:164853) | gland (BTO:0000522) | DOI (10.1021/jo00277a028) |
| Roles Classification |
|---|
| Biological Role: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-oxo-nonan-1-ol (CHEBI:179888) has role pheromone (CHEBI:26013) |
| 6-oxo-nonan-1-ol (CHEBI:179888) is a aliphatic alcohol (CHEBI:2571) |
| 6-oxo-nonan-1-ol (CHEBI:179888) is a dialkyl ketone (CHEBI:18044) |
| 6-oxo-nonan-1-ol (CHEBI:179888) is a medium-chain primary fatty alcohol (CHEBI:142605) |
| IUPAC Name |
|---|
| 9-hydroxynonan-4-one |
| Synonyms | Source |
|---|---|
| 9-hydroxy-4-nonanone | ChEBI |
| 6-oxo-1-nonanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA05000138 | LIPID MAPS |
| 9587414 | ChemSpider |
| Citations |
|---|