EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O7S |
| Net Charge | 0 |
| Average Mass | 274.250 |
| Monoisotopic Mass | 274.01472 |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1OS(=O)(=O)O |
| InChI | InChI=1S/C10H10O7S/c1-16-8-4-2-7(3-5-10(11)12)6-9(8)17-18(13,14)15/h2-6H,1H3,(H,11,12)(H,13,14,15)/b5-3+ |
| InChIKey | DCMKMHVTKFJMAU-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS3233) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoferulic acid 3-sulfate (CHEBI:179839) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(4-methoxy-3-sulooxyphenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30777634 | ChemSpider |
| HMDB0041748 | HMDB |