EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H28O2 |
| Net Charge | 0 |
| Average Mass | 228.376 |
| Monoisotopic Mass | 228.20893 |
| SMILES | CCCCCCCC(C)CCC(C)C(=O)O |
| InChI | InChI=1S/C14H28O2/c1-4-5-6-7-8-9-12(2)10-11-13(3)14(15)16/h12-13H,4-11H2,1-3H3,(H,15,16) |
| InChIKey | ABQDDNHUZOOWMZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya aestuarii (ncbitaxon:118322) | - | DOI (10.1016/0031-9422(85)80017-0) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dimethyl-dodecanoic acid (CHEBI:179792) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Names |
|---|
| 2,5-dimethyldodecanoic acid |
| (2R)-2,5-dimethyldodecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10474434 | ChemSpider |
| 4471715 | ChemSpider |
| LMFA01020189 | LIPID MAPS |