EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H11NO4 |
| Net Charge | 0 |
| Average Mass | 317.300 |
| Monoisotopic Mass | 317.06881 |
| SMILES | O=C1C(=O)N2CCc3cc4c(c5c3c2c1c1ccccc15)OCO4 |
| InChI | InChI=1S/C19H11NO4/c21-17-15-11-4-2-1-3-10(11)14-13-9(7-12-18(14)24-8-23-12)5-6-20(16(13)15)19(17)22/h1-4,7H,5-6,8H2 |
| InChIKey | FMLHJJVSHOCVAU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lettowianthine (CHEBI:179640) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| 3,5-dioxa-11-azahexacyclo[9.9.2.02,6.08,21.014,22.015,20]docosa-1(21),2(6),7,14(22),15,17,19-heptaene-12,13-dione |
| Manual Xrefs | Databases |
|---|---|
| 10216687 | ChemSpider |
| HMDB0034923 | HMDB |