EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H4O3 |
| Net Charge | 0 |
| Average Mass | 88.062 |
| Monoisotopic Mass | 88.01604 |
| SMILES | [H]C(=O)CC(=O)O |
| InChI | InChI=1S/C3H4O3/c4-2-1-3(5)6/h2H,1H2,(H,5,6) |
| InChIKey | OAKURXIZZOAYBC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxopropanoic acid (CHEBI:17960) has functional parent propionic acid (CHEBI:30768) |
| 3-oxopropanoic acid (CHEBI:17960) is a aldehydic acid (CHEBI:26643) |
| 3-oxopropanoic acid (CHEBI:17960) is conjugate acid of 3-oxopropanoate (CHEBI:33190) |
| Incoming Relation(s) |
| 3-oxopropanoyl-CoA (CHEBI:28673) has functional parent 3-oxopropanoic acid (CHEBI:17960) |
| 3-oxopropanoate (CHEBI:33190) is conjugate base of 3-oxopropanoic acid (CHEBI:17960) |
| IUPAC Name |
|---|
| 3-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| formylacetic acid | ChEBI |
| malonic semialdehyde | ChemIDplus |