EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N4O4 |
| Net Charge | 0 |
| Average Mass | 238.203 |
| Monoisotopic Mass | 238.07020 |
| SMILES | CC(O)C(=O)C1=Nc2c(nc(=O)nc2=O)NC1 |
| InChI | InChI=1S/C9H10N4O4/c1-3(14)6(15)4-2-10-7-5(11-4)8(16)13-9(17)12-7/h3,14H,2H2,1H3,(H3,10,12,13,16,17) |
| InChIKey | PINNBMAOEJRIQL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthopterin-B2 (CHEBI:17953) has functional parent rac-lactic acid (CHEBI:28358) |
| xanthopterin-B2 (CHEBI:17953) has role animal metabolite (CHEBI:75767) |
| xanthopterin-B2 (CHEBI:17953) is a pteridines (CHEBI:26373) |
| xanthopterin-B2 (CHEBI:17953) is a secondary α-hydroxy ketone (CHEBI:2468) |
| Incoming Relation(s) |
| (S)-xanthopterin-B2 (CHEBI:233231) is a xanthopterin-B2 (CHEBI:17953) |
| IUPAC Name |
|---|
| 6-lactoyl-7,8-dihydropteridine-2,4(1H,3H)-dione |
| Synonyms | Source |
|---|---|
| Xanthopterin-B2 | KEGG COMPOUND |
| 1-(7,8-Dihydro-2,4-dihydroxypteridin-6-yl)-2-hydroxypropan-1-one | KEGG COMPOUND |