EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O2 |
| Net Charge | 0 |
| Average Mass | 128.171 |
| Monoisotopic Mass | 128.08373 |
| SMILES | CCC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C7H12O2/c1-3-4-5-6(2)7(8)9/h5H,3-4H2,1-2H3,(H,8,9)/b6-5+ |
| InChIKey | AKOVMBAFZSPEQU-AATRIKPKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-2E-hexenoic acid (CHEBI:179470) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-2-methylhex-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020101 | LIPID MAPS |
| 4445777 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:28897-58-7 | ChemIDplus |