EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O2 |
| Net Charge | 0 |
| Average Mass | 128.171 |
| Monoisotopic Mass | 128.08373 |
| SMILES | CCC/C(C)=C\C(=O)O |
| InChI | InChI=1S/C7H12O2/c1-3-4-6(2)5-7(8)9/h5H,3-4H2,1-2H3,(H,8,9)/b6-5- |
| InChIKey | NTWSIWWJPQHFTO-WAYWQWQTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methyl-2Z-hexenoic acid (CHEBI:179467) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (Z)-3-methylhex-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24841859 | ChemSpider |
| LMFA01030794 | LIPID MAPS |