EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O2 |
| Net Charge | 0 |
| Average Mass | 128.171 |
| Monoisotopic Mass | 128.08373 |
| SMILES | CC/C=C\CCC(=O)O |
| InChI | InChI=1S/C7H12O2/c1-2-3-4-5-6-7(8)9/h3-4H,2,5-6H2,1H3,(H,8,9)/b4-3- |
| InChIKey | KFXPOIKSDYRVKS-ARJAWSKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4Z-heptenoic acid (CHEBI:179463) is a medium-chain fatty acid (CHEBI:59554) |
| Incoming Relation(s) |
| (4Z)-heptenoate (CHEBI:747792) is conjugate base of 4Z-heptenoic acid (CHEBI:179463) |
| IUPAC Name |
|---|
| (Z)-hept-4-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472020 | ChemSpider |
| HMDB0033793 | HMDB |
| LMFA01030452 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:41653-95-6 | ChemIDplus |