EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O6S |
| Net Charge | 0 |
| Average Mass | 170.142 |
| Monoisotopic Mass | 169.98851 |
| SMILES | C[C@H](OS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C3H6O6S/c1-2(3(4)5)9-10(6,7)8/h2H,1H3,(H,4,5)(H,6,7,8)/t2-/m0/s1 |
| InChIKey | CSRZVBCXQYEYKY-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-O-sulfolactic acid (CHEBI:17943) is a 2-O-sulfolactic acid (CHEBI:48289) |
| (S)-2-O-sulfolactic acid (CHEBI:17943) is conjugate acid of (S)-2-O-sulfonatolactate(2−) (CHEBI:61287) |
| (S)-2-O-sulfolactic acid (CHEBI:17943) is enantiomer of (R)-2-O-sulfolactic acid (CHEBI:48290) |
| Incoming Relation(s) |
| (S)-2-O-sulfonatolactate(2−) (CHEBI:61287) is conjugate base of (S)-2-O-sulfolactic acid (CHEBI:17943) |
| (R)-2-O-sulfolactic acid (CHEBI:48290) is enantiomer of (S)-2-O-sulfolactic acid (CHEBI:17943) |
| IUPAC Name |
|---|
| (2S)-2-(sulfooxy)propanoic acid |
| Synonyms | Source |
|---|---|
| (S)-2-O-Sulfolactate | KEGG COMPOUND |
| (S)-2-O-sulfolactate | ChEBI |