EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H20O5 |
| Net Charge | 0 |
| Average Mass | 388.419 |
| Monoisotopic Mass | 388.13107 |
| SMILES | O=C1CC(c2ccccc2)c2c(O)cc(O)c(C(=O)CCc3ccccc3)c2O1 |
| InChI | InChI=1S/C24H20O5/c25-18(12-11-15-7-3-1-4-8-15)23-20(27)14-19(26)22-17(13-21(28)29-24(22)23)16-9-5-2-6-10-16/h1-10,14,17,26-27H,11-13H2 |
| InChIKey | AFAVBHVAMSRTSZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calomelanol D-1 (CHEBI:179409) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-4-phenyl-8-(3-phenylpropanoyl)-3,4-dihydrochromen-2-one |
| Manual Xrefs | Databases |
|---|---|
| 24846077 | ChemSpider |
| LMPK12120495 | LIPID MAPS |