EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O7 |
| Net Charge | 0 |
| Average Mass | 202.118 |
| Monoisotopic Mass | 202.01135 |
| SMILES | O=C(O)C/C(=C/C(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H6O7/c8-4(7(13)14)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,9,10)(H,11,12)(H,13,14)/b3-1- |
| InChIKey | POTZSFVTPSBXLW-IWQZZHSRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z)-4-oxobut-2-ene-1,2,4-tricarboxylic acid (CHEBI:1794) is a enone (CHEBI:51689) |
| (2Z)-4-oxobut-2-ene-1,2,4-tricarboxylic acid (CHEBI:1794) is a tricarboxylic acid (CHEBI:27093) |
| (2Z)-4-oxobut-2-ene-1,2,4-tricarboxylic acid (CHEBI:1794) is conjugate acid of (2Z)-4-oxobut-2-ene-1,2,4-tricarboxylate (CHEBI:142690) |
| Incoming Relation(s) |
| (2Z)-4-oxobut-2-ene-1,2,4-tricarboxylate (CHEBI:142690) is conjugate base of (2Z)-4-oxobut-2-ene-1,2,4-tricarboxylic acid (CHEBI:1794) |
| IUPAC Name |
|---|
| (2Z)-4-oxobut-2-ene-1,2,4-tricarboxylic acid |
| Synonym | Source |
|---|---|
| (3Z)-4-carboxy-2-oxohex-3-enedioic acid | ChEBI |
| Citations |
|---|