EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N7O5 |
| Net Charge | 0 |
| Average Mass | 471.518 |
| Monoisotopic Mass | 471.22302 |
| SMILES | COc1ccc(C[C@H](N)C(=O)N[C@H]2[C@@H](O)[C@H](n3cnc4c(N(C)C)ncnc43)O[C@@H]2CO)cc1 |
| InChI | InChI=1S/C22H29N7O5/c1-28(2)19-17-20(25-10-24-19)29(11-26-17)22-18(31)16(15(9-30)34-22)27-21(32)14(23)8-12-4-6-13(33-3)7-5-12/h4-7,10-11,14-16,18,22,30-31H,8-9,23H2,1-3H3,(H,27,32)/t14-,15+,16+,18+,22+/m0/s1 |
| InChIKey | RXWNCPJZOCPEPQ-NVWDDTSBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.11.14 (cytosol alanyl aminopeptidase) inhibitor An EC 3.4.11.* (aminopeptidase) inhibitor that interferes with the action of cytosol alanyl aminopeptidase (EC 3.4.11.14). protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 3.4.14.2 (dipeptidyl-peptidase II) inhibitor An EC 3.4.14.* (dipeptidyl- and tripeptidyl-peptidases) inhibitor that interferes with the action of dipeptidyl-peptidase II (EC 3.4.14.2). |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| puromycin (CHEBI:17939) has role antiinfective agent (CHEBI:35441) |
| puromycin (CHEBI:17939) has role antimicrobial agent (CHEBI:33281) |
| puromycin (CHEBI:17939) has role antineoplastic agent (CHEBI:35610) |
| puromycin (CHEBI:17939) has role EC 3.4.11.14 (cytosol alanyl aminopeptidase) inhibitor (CHEBI:76891) |
| puromycin (CHEBI:17939) has role EC 3.4.14.2 (dipeptidyl-peptidase II) inhibitor (CHEBI:76893) |
| puromycin (CHEBI:17939) has role nucleoside antibiotic (CHEBI:25605) |
| puromycin (CHEBI:17939) has role protein synthesis inhibitor (CHEBI:48001) |
| puromycin (CHEBI:17939) is a puromycins (CHEBI:26404) |
| puromycin (CHEBI:17939) is conjugate base of puromycin(1+) (CHEBI:60255) |
| Incoming Relation(s) |
| puromycin 5'-phosphate (CHEBI:26403) has functional parent puromycin (CHEBI:17939) |
| puromycin(1+) (CHEBI:60255) is conjugate acid of puromycin (CHEBI:17939) |
| IUPAC Name |
|---|
| 3'-deoxy-N,N-dimethyl-3'-(O-methyl-L-tyrosinamido)adenosine |
| INNs | Source |
|---|---|
| puromicina | ChemIDplus |
| puromycin | ChemIDplus |
| puromycine | ChemIDplus |
| puromycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3'-[[(2S)-2-amino-3-(4-methoxyphenyl)-1-oxopropyl]amino]-3'-deoxy-N,N-diemthyladenosine | ChEBI |
| 3'-(L-alpha-Amino-p-methoxyhydrocinnamamido)-3'-deoxy-N,N-dimethyladenosine | ChemIDplus |
| 9-{3-deoxy-3-[(O-methyl-L-tyrosyl)amino]-β-D-xylofuranosyl}-N,N-dimethyl-9H-purin-6-amine | ChEBI |
| Achromycin | ChemIDplus |
| Puromycin | KEGG COMPOUND |
| (S)-3'-((2-Amino-3-(4-methoxyphenyl)-1-oxopropyl)amino)-3'-deoxy-N,N-dimethyladenosine | ChemIDplus |
| Citations |
|---|