EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4 |
| Net Charge | 0 |
| Average Mass | 204.226 |
| Monoisotopic Mass | 204.11101 |
| SMILES | CC(=O)NCC(O)CCC(N)C(=O)O |
| InChI | InChI=1S/C8H16N2O4/c1-5(11)10-4-6(12)2-3-7(9)8(13)14/h6-7,12H,2-4,9H2,1H3,(H,10,11)(H,13,14) |
| InChIKey | FVTTTYGNCVTXEI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-Acetyl-5S-hydroxy-L-lysine (CHEBI:179366) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 6-acetamido-2-amino-5-hydroxyhexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033891 | HMDB |
| 35013672 | ChemSpider |