EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H38O6 |
| Net Charge | 0 |
| Average Mass | 422.562 |
| Monoisotopic Mass | 422.26684 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])[C@H](O)C(=O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C24H38O6/c1-12(4-7-18(27)28)15-5-6-16-19-17(26)11-13-10-14(25)8-9-23(13,2)20(19)21(29)22(30)24(15,16)3/h12-17,19-21,25-26,29H,4-11H2,1-3H3,(H,27,28)/t12-,13+,14-,15-,16+,17-,19-,20-,21+,23+,24-/m1/s1 |
| InChIKey | DUHZPNGFRJKFOH-DCZNNHDUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3alpha,7alpha,11alpha-Trihydroxy-12-oxo-5beta-cholan-24-oic Acid (CHEBI:179324) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(3R,5S,7R,8S,9S,10S,11S,13R,14S,17R)-3,7,11-trihydroxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4447246 | ChemSpider |
| LMST04010415 | LIPID MAPS |