EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16O |
| Net Charge | 0 |
| Average Mass | 116.204 |
| Monoisotopic Mass | 116.12012 |
| SMILES | CCCCC(O)CC |
| InChI | InChI=1S/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | RZKSECIXORKHQS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coffea arabica (ncbitaxon:13443) | - | PubMed (35685183) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptan-3-ol (CHEBI:179170) has role plant metabolite (CHEBI:76924) |
| heptan-3-ol (CHEBI:179170) is a heptanol (CHEBI:195607) |
| heptan-3-ol (CHEBI:179170) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| heptan-3-ol |
| Synonyms | Source |
|---|---|
| 1-ethyl-1-pentanol | NIST Chemistry WebBook |
| 3-heptanol | NIST Chemistry WebBook |
| 3-heptyl alcohol | ChEBI |
| 3-hydroxyheptane | NIST Chemistry WebBook |
| butyl ethyl carbinol | ChEBI |
| butylethylcarbinol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 11036 | ChemSpider |
| 3-Heptanol | Wikipedia |
| HMDB0031481 | HMDB |
| LMFA05000483 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1719067 | Reaxys |
| CAS:589-82-2 | NIST Chemistry WebBook |
| Citations |
|---|