EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | [H]C(=O)CCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H11NO3/c7-5(6(9)10)3-1-2-4-8/h4-5H,1-3,7H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | GFXYTQPNNXGICT-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-allysine (CHEBI:17917) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-allysine (CHEBI:17917) has role human metabolite (CHEBI:77746) |
| L-allysine (CHEBI:17917) has role mouse metabolite (CHEBI:75771) |
| L-allysine (CHEBI:17917) is a allysine (CHEBI:17027) |
| L-allysine (CHEBI:17917) is a aminoadipate semialdehyde (CHEBI:22490) |
| L-allysine (CHEBI:17917) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-allysine (CHEBI:17917) is tautomer of L-allysine zwitterion (CHEBI:58321) |
| Incoming Relation(s) |
| L-allysine residue (CHEBI:131803) is substituent group from L-allysine (CHEBI:17917) |
| L-allysine zwitterion (CHEBI:58321) is tautomer of L-allysine (CHEBI:17917) |
| IUPAC Names |
|---|
| (2S)-2-amino-6-oxohexanoic acid |
| L-allysine |
| Synonyms | Source |
|---|---|
| L-2-Aminoadipate 6-semialdehyde | KEGG COMPOUND |
| L-6-oxonorleucine | ChEBI |
| 6-oxo-L-norleucine | ChEBI |
| 2-AMINO-6-OXO-HEXANOIC ACID | PDBeChem |
| Allysine | KEGG COMPOUND |
| L-Allysine | KEGG COMPOUND |