EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO4 |
| Net Charge | 0 |
| Average Mass | 445.644 |
| Monoisotopic Mass | 445.31921 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)C(=O)N[C@H](C)C(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C27H43NO4/c1-16-20(14-21(29)15-24(16)30)10-9-19-8-7-13-27(6)22(11-12-23(19)27)17(2)25(31)28-18(3)26(4,5)32/h9-10,17-18,21-24,29-30,32H,1,7-8,11-15H2,2-6H3,(H,28,31)/b19-9+,20-10-/t17-,18+,21+,22+,23-,24-,27+/m0/s1 |
| InChIKey | ZIGSRBCVYAJTAZ-MGLBYPHHSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1alpha,25-dihydroxy-24-oxo-23-azavitamin D2 / 1alpha,25-dihydroxy-24-oxo-23-azaergocalciferol (CHEBI:179142) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (2S)-2-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-N-[(2R)-3-hydroxy-3-methylbutan-2-yl]propanamide |
| Manual Xrefs | Databases |
|---|---|
| 7826163 | ChemSpider |
| LMST03010007 | LIPID MAPS |