EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H74NO10P |
| Net Charge | 0 |
| Average Mass | 760.003 |
| Monoisotopic Mass | 759.50503 |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C40H74NO10P/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32-39(43)51-36(34-49-52(46,47)50-35-37(41)40(44)45)33-48-38(42)31-29-27-25-23-21-16-14-12-10-8-6-4-2/h12,14,18-19,36-37H,3-11,13,15-17,20-35,41H2,1-2H3,(H,44,45)(H,46,47)/b14-12-,19-18-/t36-,37+/m1/s1 |
| InChIKey | CMUGURPPQBHSKY-RAXLQKJMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PS(15:1(9Z)/19:1(9Z)) (CHEBI:179121) is a phosphatidyl-L-serine (CHEBI:18303) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[hydroxy-[(2R)-2-[(Z)-nonadec-9-enoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMGP03010179 | LIPID MAPS |