EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H39NO2 |
| Net Charge | 0 |
| Average Mass | 301.515 |
| Monoisotopic Mass | 301.29808 |
| SMILES | CCCCCCCCCCCCCCC[C@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17-18,20-21H,2-16,19H2,1H3/t17-,18-/m0/s1 |
| InChIKey | OTKJDMGTUTTYMP-ROUUACIJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Safingol ( L-threo-sphinganine) (CHEBI:179060) has role antineoplastic agent (CHEBI:35610) |
| Safingol ( L-threo-sphinganine) (CHEBI:179060) is a amino alcohol (CHEBI:22478) |
| IUPAC Name |
|---|
| (2S,3S)-2-aminooctadecane-1,3-diol |
| Synonyms | Source |
|---|---|
| NSC-714503 | ChEMBL |
| safingol | ChEMBL |
| Safingol hydrochloride | ChEMBL |
| SPC-100270 | ChEMBL |
| Threo-dihydrosphingosine,l- | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2319840 | ChemSpider |
| D05784 | KEGG DRUG |
| DB11924 | DrugBank |
| LMSP01080055 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:15639-50-6 | ChemIDplus |
| Citations |
|---|