EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N5O4 |
| Net Charge | 0 |
| Average Mass | 253.218 |
| Monoisotopic Mass | 253.08110 |
| SMILES | Nc1nc(=O)c2nc([C@@H](O)[C@H](O)CO)cnc2n1 |
| InChI | InChI=1S/C9H11N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h1,4,6,15-17H,2H2,(H3,10,11,13,14,18)/t4-,6-/m1/s1 |
| InChIKey | BMQYVXCPAOLZOK-INEUFUBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tetrahymena pyriformis (ncbitaxon:5908) | - | PubMed (1782220) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | eukaryotic metabolite Any metabolite produced during a metabolic reaction in eukaryotes, the taxon that include members of the fungi, plantae and animalia kingdoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-threo-neopterin (CHEBI:179056) has role eukaryotic metabolite (CHEBI:75763) |
| D-threo-neopterin (CHEBI:179056) is a neopterin (CHEBI:28670) |
| IUPAC Name |
|---|
| 2-amino-6-[(1R,2R)-1,2,3-trihydroxypropyl]pteridin-4(3H)-one |
| Synonyms | Source |
|---|---|
| 6-D-threo-monapterin | ChEBI |
| monapterin | DrugBank |
| D-6-(threo-1',2',3'-trihydroxypropyl)pterin | ChEBI |
| D-threo-monapterin | ChEBI |
| D-(−)-monapterin | ChEBI |
| D-monapterin | ChEBI |
| Citations |
|---|