EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7BrO2 |
| Net Charge | 0 |
| Average Mass | 215.046 |
| Monoisotopic Mass | 213.96294 |
| SMILES | O=C(O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H7BrO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | QOWSWEBLNVACCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Bromophenyl acetate (CHEBI:1790) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| 4-Bromophenyl acetate | KEGG COMPOUND |
| 4-Bromophenylacetic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03076 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:1878-68-8 | KEGG COMPOUND |