EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17898 - all-trans-retinal
| Formula | C20H28O |
| Net Charge | 0 |
| Average Mass | 284.443 |
| Monoisotopic Mass | 284.21402 |
| SMILES | [H]C(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
| InChIKey | NCYCYZXNIZJOKI-OVSJKPMPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 165-177. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp., Basel, Switzerland c1981-1992.) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). gap junctional intercellular communication inhibitor An inhibitor that interferes with the process of gap junctional intercellular communication. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-retinal (CHEBI:17898) has role gap junctional intercellular communication inhibitor (CHEBI:67195) |
| all-trans-retinal (CHEBI:17898) has role human metabolite (CHEBI:77746) |
| all-trans-retinal (CHEBI:17898) has role mouse metabolite (CHEBI:75771) |
| all-trans-retinal (CHEBI:17898) is a retinal (CHEBI:15035) |
| all-trans-retinal (CHEBI:17898) is a vitamin A (CHEBI:12777) |
| Incoming Relation(s) |
| (3R)-all-trans-3-hydroxyretinal (CHEBI:52228) has functional parent all-trans-retinal (CHEBI:17898) |
| (3S)-all-trans-3-hydroxyretinal (CHEBI:52229) has functional parent all-trans-retinal (CHEBI:17898) |
| N-retinylidenephosphatidylethanolamine (CHEBI:71063) has functional parent all-trans-retinal (CHEBI:17898) |
| all-trans-4-hydroxyretinal (CHEBI:139346) has functional parent all-trans-retinal (CHEBI:17898) |
| all-trans-4-oxoretinal (CHEBI:139347) has functional parent all-trans-retinal (CHEBI:17898) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenal |
| Synonyms | Source |
|---|---|
| retinal | KEGG COMPOUND |
| vitamin A aldehyde | KEGG COMPOUND |
| retinene | KEGG COMPOUND |
| all-trans-retinal | KEGG COMPOUND |
| all-trans-vitamin A aldehyde | KEGG COMPOUND |
| all-trans-retinene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| all-trans-retinal | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00376 | KEGG COMPOUND |
| LMPR01090002 | LIPID MAPS |
| Retinal | Wikipedia |
| RET | PDBeChem |
| HMDB0001358 | HMDB |
| RETINAL | MetaCyc |
| 553582 | ChemSpider |
| FDB030668 | FooDB |
| Citations |
|---|