EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O |
| Net Charge | 0 |
| Average Mass | 284.443 |
| Monoisotopic Mass | 284.21402 |
| SMILES | [H]C(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
| InChIKey | NCYCYZXNIZJOKI-OVSJKPMPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 165-177. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp., Basel, Switzerland c1981-1992.) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). gap junctional intercellular communication inhibitor An inhibitor that interferes with the process of gap junctional intercellular communication. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-retinal (CHEBI:17898) has role gap junctional intercellular communication inhibitor (CHEBI:67195) |
| all-trans-retinal (CHEBI:17898) has role human metabolite (CHEBI:77746) |
| all-trans-retinal (CHEBI:17898) has role mouse metabolite (CHEBI:75771) |
| all-trans-retinal (CHEBI:17898) is a retinal (CHEBI:15035) |
| all-trans-retinal (CHEBI:17898) is a vitamin A (CHEBI:12777) |
| Incoming Relation(s) |
| (3R)-all-trans-3-hydroxyretinal (CHEBI:52228) has functional parent all-trans-retinal (CHEBI:17898) |
| (3S)-all-trans-3-hydroxyretinal (CHEBI:52229) has functional parent all-trans-retinal (CHEBI:17898) |
| N-retinylidenephosphatidylethanolamine (CHEBI:71063) has functional parent all-trans-retinal (CHEBI:17898) |
| all-trans-4-hydroxyretinal (CHEBI:139346) has functional parent all-trans-retinal (CHEBI:17898) |
| all-trans-4-oxoretinal (CHEBI:139347) has functional parent all-trans-retinal (CHEBI:17898) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraenal |
| Synonyms | Source |
|---|---|
| axerophthal | MetaCyc |
| all-E-retinal | ChemIDplus |
| all-trans-retinal | KEGG COMPOUND |
| all-trans-retinene | KEGG COMPOUND |
| all-trans-vitamin A aldehyde | KEGG COMPOUND |
| all-trans-retinaldehyde | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| all-trans-retinal | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 553582 | ChemSpider |
| C00376 | KEGG COMPOUND |
| FDB030668 | FooDB |
| HMDB0001358 | HMDB |
| LMPR01090002 | LIPID MAPS |
| RET | PDBeChem |
| Retinal | Wikipedia |
| RETINAL | MetaCyc |
| Citations |
|---|