EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO2 |
| Net Charge | 0 |
| Average Mass | 177.203 |
| Monoisotopic Mass | 177.07898 |
| SMILES | C[C@H]1CCc2c(C(=O)O)cncc21 |
| InChI | InChI=1S/C10H11NO2/c1-6-2-3-7-8(6)4-11-5-9(7)10(12)13/h4-6H,2-3H2,1H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | RLNQBGQGMYNOCX-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Plantagonine (CHEBI:178979) is a aromatic carboxylic acid (CHEBI:33859) |
| Plantagonine (CHEBI:178979) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| (7S)-7-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 52083452 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:21913-34-8 | ChemIDplus |