EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N5O |
| Net Charge | 0 |
| Average Mass | 221.264 |
| Monoisotopic Mass | 221.12766 |
| SMILES | C[C@@H](CO)CCNc1ncnc2ncnc12 |
| InChI | InChI=1S/C10H15N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h5-7,16H,2-4H2,1H3,(H2,11,12,13,14,15)/t7-/m1/s1 |
| InChIKey | XXFACTAYGKKOQB-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrozeatin (CHEBI:17874) has role cytokinin (CHEBI:23530) |
| dihydrozeatin (CHEBI:17874) has role plant metabolite (CHEBI:76924) |
| dihydrozeatin (CHEBI:17874) is a 6-alkylaminopurine (CHEBI:17524) |
| Incoming Relation(s) |
| N-glycosyldihydrozeatin (CHEBI:38638) has functional parent dihydrozeatin (CHEBI:17874) |
| O-β-D-glucosyldihydrozeatin (CHEBI:21948) has functional parent dihydrozeatin (CHEBI:17874) |
| 9-alanyldihydrozeatin (CHEBI:20819) has functional parent dihydrozeatin (CHEBI:17874) |
| IUPAC Name |
|---|
| (2R)-2-methyl-4-(7H-purin-6-ylamino)butan-1-ol |
| Synonyms | Source |
|---|---|
| Dihydrozeatin | KEGG COMPOUND |
| 2-methyl-4-(9H-purin-6-ylamino)butan-1-ol | ChEBI |
| N6-(4-hydroxyisopentanyl)adenine | IUBMB |
| 2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol | KEGG COMPOUND |
| N6-(4-Hydroxyisopentanyl)adenine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| dihydrozeatin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02029 | KEGG COMPOUND |
| CPD-332 | MetaCyc |
| WA2 | PDBeChem |
| HMDB0012215 | HMDB |
| C00000093 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1215977 | Reaxys |
| CAS:23599-75-9 | KEGG COMPOUND |
| CAS:23599-75-9 | ChemIDplus |
| Citations |
|---|