EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O4 |
| Net Charge | 0 |
| Average Mass | 416.602 |
| Monoisotopic Mass | 416.29266 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CC[C@H](O)C3CO3)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C26H40O4/c1-16(6-11-23(28)25-15-30-25)21-9-10-22-18(5-4-12-26(21,22)3)7-8-19-13-20(27)14-24(29)17(19)2/h7-8,16,20-25,27-29H,2,4-6,9-15H2,1,3H3/b18-7+,19-8-/t16-,20-,21-,22+,23+,24+,25?,26-/m1/s1 |
| InChIKey | CKMUTKJMMMBQHA-ASSMWGRUSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24S,25R)-25,26-epoxy-1alpha,24-dihydroxy-27-norvitamin D3 / (24S,25R)-25,26-epoxy-1alpha,24-dihydroxy-27-norcholecalciferol (CHEBI:178728) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,5S)-5-hydroxy-5-(oxiran-2-yl)pentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| LMST03020038 | LIPID MAPS |
| 7826238 | ChemSpider |