EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O4 |
| Net Charge | 0 |
| Average Mass | 416.602 |
| Monoisotopic Mass | 416.29266 |
| SMILES | [H][C@@]12CC=C([C@H](C)CCC(=O)C(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1C[C@@H](O)C[C@H](O)C1 |
| InChI | InChI=1S/C26H40O4/c1-17(7-12-24(29)25(2,3)30)22-10-11-23-19(6-5-13-26(22,23)4)9-8-18-14-20(27)16-21(28)15-18/h8-10,17,20-21,23,27-28,30H,5-7,11-16H2,1-4H3/b19-9+/t17-,20-,21-,23+,26-/m1/s1 |
| InChIKey | KEHHENHIHMFJAY-AVVHVZKBSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1alpha,25-Dihydroxy-16-ene-19-nor-24-oxovitamin D3 (CHEBI:178726) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (6R)-6-[(3aS,4E,7aS)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-2-hydroxy-2-methylheptan-3-one |
| Manual Xrefs | Databases |
|---|---|
| 24823359 | ChemSpider |
| LMST03020609 | LIPID MAPS |