EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17872 - 2-oxo-2H-pyran-4,6-dicarboxylic acid
| Formula | C7H4O6 |
| Net Charge | 0 |
| Average Mass | 184.103 |
| Monoisotopic Mass | 184.00079 |
| SMILES | O=C(O)c1cc(C(=O)O)oc(=O)c1 |
| InChI | InChI=1S/C7H4O6/c8-5-2-3(6(9)10)1-4(13-5)7(11)12/h1-2H,(H,9,10)(H,11,12) |
| InChIKey | VRMXCPVFSJVVCA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxo-2H-pyran-4,6-dicarboxylic acid (CHEBI:17872) is a pyrandicarboxylic acid (CHEBI:36197) |
| 2-oxo-2H-pyran-4,6-dicarboxylic acid (CHEBI:17872) is conjugate acid of 2-oxo-2H-pyran-4,6-dicarboxylate (CHEBI:58304) |
| Incoming Relation(s) |
| 2-oxo-2H-pyran-4,6-dicarboxylate (CHEBI:58304) is conjugate base of 2-oxo-2H-pyran-4,6-dicarboxylic acid (CHEBI:17872) |
| IUPAC Name |
|---|
| 2-oxo-2H-pyran-4,6-dicarboxylic acid |
| Synonym | Source |
|---|---|
| 2-Pyrone-4,6-dicarboxylate | KEGG COMPOUND |