EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O4 |
| Net Charge | 0 |
| Average Mass | 388.548 |
| Monoisotopic Mass | 388.26136 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CCC(=O)O)[C@@]4(C)CC(=O)[C@]3([H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C24H36O4/c1-14(4-9-21(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)22(17)20(26)13-24(18,19)3/h14-15,17-19,22H,4-13H2,1-3H3,(H,27,28)/t14-,15-,17+,18-,19+,22-,23+,24-/m1/s1 |
| InChIKey | SWQLMNAURFIKGL-XMIYWWMASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,11-Dioxo-5beta-cholan-24-oic Acid (CHEBI:178708) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(5R,8S,9S,10S,13R,14S,17R)-10,13-dimethyl-3,11-dioxo-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4447131 | ChemSpider |
| LMST04010290 | LIPID MAPS |