EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O2.C2H7NO |
| Net Charge | 0 |
| Average Mass | 343.552 |
| Monoisotopic Mass | 343.30864 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.NCCO |
| InChI | InChI=1S/C18H34O2.C2H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3-1-2-4/h9-10H,2-8,11-17H2,1H3,(H,19,20);4H,1-3H2/b10-9-; |
| InChIKey | KGWDUNBJIMUFAP-KVVVOXFISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethanolamine Oleate (CHEBI:178699) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 2-aminoethanol;(Z)-octadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| Ethanolamine oleate | ChEMBL |
| NSC-760382 | ChEMBL |
| Brand Names | Source |
|---|---|
| Ethamolin | ChEMBL |
| Oldamin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4445632 | ChemSpider |
| D02276 | KEGG DRUG |
| DB06689 | DrugBank |
| HMDB0015638 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2272-11-9 | ChemIDplus |
| Citations |
|---|